cas: 215655-20-2 — see every product listed under this CAS number, including other names
1-[(2-chloro-6-fluorophenyl)methyl]piperazine, ≥98%, ≥98% (CAS 215655-20-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118PX8-250mg |
| cas | 215655-20-2 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 693.20 Pln | |
| Chemat | 5g | 2267.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
1-[(2-chloro-6-fluorophenyl)methyl]piperazine (CAS 215655-20-2) is a chemical compound with the molecular formula C11H14ClFN2 and a molecular weight of 228.69 g/mol. IUPAC name: 1-[(2-chloro-6-fluorophenyl)methyl]piperazine. InChIKey: PBJVZHBDDDMHIT-UHFFFAOYSA-N.
| Molecular formula | C11H14ClFN2 |
|---|---|
| Molecular weight | 228.69 g/mol |
| IUPAC name | 1-[(2-chloro-6-fluorophenyl)methyl]piperazine |
| InChIKey | PBJVZHBDDDMHIT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=C(C=CC=C2Cl)F |
Computed by PubChem (NCBI)