CAS 118630-33-4 is the registry number for 1-(2-Chloro-4-fluorobenzyl)piperazine. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg.
1-[(2-chloro-4-fluorophenyl)methyl]piperazine (CAS 118630-33-4) is a chemical compound with the molecular formula C11H14ClFN2 and a molecular weight of 228.69 g/mol. IUPAC name: 1-[(2-chloro-4-fluorophenyl)methyl]piperazine. InChIKey: WWHXLQXVHUCVRZ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClFN2 |
|---|---|
| Molecular weight | 228.69 g/mol |
| IUPAC name | 1-[(2-chloro-4-fluorophenyl)methyl]piperazine |
| InChIKey | WWHXLQXVHUCVRZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=C(C=C(C=C2)F)Cl |
Computed by PubChem (NCBI)