CAS 1048343-51-6 appears in our catalog under these names: 2-(5-Fluoro-2-methyl-1h-indol-3-yl)ethanamine hydrochloride, 95%, 2-(5-Fluoro-2-methyl-1H-indol-3-yl)ethan-1-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1048343-51-6) is a chemical compound with the molecular formula C11H14ClFN2 and a molecular weight of 228.69 g/mol. IUPAC name: 2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: UJHALVSHVYZJDN-UHFFFAOYSA-N.
| Molecular formula | C11H14ClFN2 |
|---|---|
| Molecular weight | 228.69 g/mol |
| IUPAC name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | UJHALVSHVYZJDN-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1)C=CC(=C2)F)CCN.Cl |
Computed by PubChem (NCBI)