CAS 1715033-46-7 is the registry number for Rel-(3R,4S)-4-(3-chloro-4-fluorophenyl)-1-methylpyrrolidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-4-(3-chloro-4-fluorophenyl)-1-methylpyrrolidin-3-amine (CAS 1715033-46-7) is a chemical compound with the molecular formula C11H14ClFN2 and a molecular weight of 228.69 g/mol. IUPAC name: (3R,4S)-4-(3-chloro-4-fluorophenyl)-1-methylpyrrolidin-3-amine. InChIKey: JBDSRAZSVJWEBJ-KCJUWKMLSA-N.
| Molecular formula | C11H14ClFN2 |
|---|---|
| Molecular weight | 228.69 g/mol |
| IUPAC name | (3R,4S)-4-(3-chloro-4-fluorophenyl)-1-methylpyrrolidin-3-amine |
| InChIKey | JBDSRAZSVJWEBJ-KCJUWKMLSA-N |
| SMILES | CN1C[C@@H]([C@H](C1)N)C2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)