Products 776-56-7
CAS 776-56-7 appears in our catalog under these names: 5–fluoro AMT (hydrochloride), 1-(5-Fluoro-1H-indol-3-yl)-2-propanaminium chloride, 5-Fluoro-α-methyltryptamine (hydrochloride). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 1 mg, 5 mg.
1-(5-fluoro-1H-indol-3-yl)propan-2-amine;hydrochloride (CAS 776-56-7) is a chemical compound with the molecular formula C11H14ClFN2 and a molecular weight of 228.69 g/mol. IUPAC name: 1-(5-fluoro-1H-indol-3-yl)propan-2-amine;hydrochloride. InChIKey: RVHBLKWBRZWGLS-UHFFFAOYSA-N.
| Molecular formula | C11H14ClFN2 |
|---|---|
| Molecular weight | 228.69 g/mol |
| IUPAC name | 1-(5-fluoro-1H-indol-3-yl)propan-2-amine;hydrochloride |
| InChIKey | RVHBLKWBRZWGLS-UHFFFAOYSA-N |
| SMILES | CC(CC1=CNC2=C1C=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)