Products 1185547-61-8

CAS 1185547-61-8 is the registry number for 2-(7-Fluoro-2-methylindole-3-yl)ethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(7-fluoro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride (CAS 1185547-61-8) is a chemical compound with the molecular formula C11H14ClFN2 and a molecular weight of 228.69 g/mol. IUPAC name: 2-(7-fluoro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: JFDFUUQLIPTXET-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClFN2
Molecular weight228.69 g/mol
IUPAC name2-(7-fluoro-2-methyl-1H-indol-3-yl)ethanamine;hydrochloride
InChIKeyJFDFUUQLIPTXET-UHFFFAOYSA-N
SMILESCC1=C(C2=C(N1)C(=CC=C2)F)CCN.Cl

Computed by PubChem (NCBI)