Products 1020253-24-0
CAS 1020253-24-0 is the registry number for 5-Chloro-2-cyclohexylamino-3-fluoropyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.
5-chloro-N-cyclohexyl-3-fluoropyridin-2-amine (CAS 1020253-24-0) is a chemical compound with the molecular formula C11H14ClFN2 and a molecular weight of 228.69 g/mol. IUPAC name: 5-chloro-N-cyclohexyl-3-fluoropyridin-2-amine. InChIKey: NEAIMLCKTCIVPG-UHFFFAOYSA-N.
| Molecular formula | C11H14ClFN2 |
|---|---|
| Molecular weight | 228.69 g/mol |
| IUPAC name | 5-chloro-N-cyclohexyl-3-fluoropyridin-2-amine |
| InChIKey | NEAIMLCKTCIVPG-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=C(C=C(C=N2)Cl)F |
Computed by PubChem (NCBI)