CAS 169814-48-6 is the registry number for 1-[3-(4-Chlorophenyl)-5-methylisoxazol-4-yl]ethan-1-one, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 10g, 25g.
1-[3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]ethanone (CAS 169814-48-6) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: 1-[3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]ethanone. InChIKey: XSAMMAPYCPHHKH-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 1-[3-(4-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]ethanone |
| InChIKey | XSAMMAPYCPHHKH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=C(C=C2)Cl)C(=O)C |
Computed by PubChem (NCBI)