cas: 3927-71-7 — see every product listed under this CAS number, including other names
1-Amino-2,3-dihydro-1H-indene-1-carboxylic acid 98% (CAS 3927-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A537400-100mg |
| cas | 3927-71-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 526.12 Pln | |
| Ambeed | 1g | 1293.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A537400 |
1-amino-2,3-dihydroindene-1-carboxylic acid (CAS 3927-71-7) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1-amino-2,3-dihydroindene-1-carboxylic acid. InChIKey: HTTPGMNPPMMMOP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1-amino-2,3-dihydroindene-1-carboxylic acid |
| InChIKey | HTTPGMNPPMMMOP-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C21)(C(=O)O)N |
Computed by PubChem (NCBI)