cas: 4921-86-2 — see every product listed under this CAS number, including other names
1-Benzoyl-3-(2-pyridyl)-2-thiourea, 97% (CAS 4921-86-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018202-10G |
| cas | 4921-86-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 372.80 Pln | |
| Fluorochem | 25g | 737.26 Pln | |
| Fluorochem | 100g | 1632.78 Pln | |
| Fluorochem | 500g | 4569.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-(pyridin-2-ylcarbamothioyl)benzamide (CAS 4921-86-2) is a chemical compound with the molecular formula C13H11N3OS and a molecular weight of 257.31 g/mol. IUPAC name: N-(pyridin-2-ylcarbamothioyl)benzamide. InChIKey: PNBLAGJAUXZQTL-UHFFFAOYSA-N.
| Molecular formula | C13H11N3OS |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | N-(pyridin-2-ylcarbamothioyl)benzamide |
| InChIKey | PNBLAGJAUXZQTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=CC=CC=N2 |
Computed by PubChem (NCBI)