cas: 4921-86-2 — see every product listed under this CAS number, including other names
N-(Pyridin-2-ylcarbamothioyl)benzamide, 95%, 95% (CAS 4921-86-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11823S-1g |
| cas | 4921-86-2 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 10g | 299.60 Pln | |
| Chemat | 25g | 597.20 Pln | |
| Chemat | 100g | 1302.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-(pyridin-2-ylcarbamothioyl)benzamide (CAS 4921-86-2) is a chemical compound with the molecular formula C13H11N3OS and a molecular weight of 257.31 g/mol. IUPAC name: N-(pyridin-2-ylcarbamothioyl)benzamide. InChIKey: PNBLAGJAUXZQTL-UHFFFAOYSA-N.
| Molecular formula | C13H11N3OS |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | N-(pyridin-2-ylcarbamothioyl)benzamide |
| InChIKey | PNBLAGJAUXZQTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=CC=CC=N2 |
Computed by PubChem (NCBI)