cas: 16077-10-4 — see every product listed under this CAS number, including other names
1-Benzyl-5-methoxyindoline-2,3-dione, 97% (CAS 16077-10-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A675673-5g |
| cas | 16077-10-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 30367.54 Pln | |
| AmBeed | 1g | 10140.97 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-benzyl-5-methoxyindole-2,3-dione (CAS 16077-10-4) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 1-benzyl-5-methoxyindole-2,3-dione. InChIKey: ZBLQKVFGHHQVMS-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 1-benzyl-5-methoxyindole-2,3-dione |
| InChIKey | ZBLQKVFGHHQVMS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N(C(=O)C2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)