CAS 351357-33-0 is the registry number for 2-(2-Furyl)-6,8-dimethylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(furan-2-yl)-6,8-dimethylquinoline-4-carboxylic acid (CAS 351357-33-0) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 2-(furan-2-yl)-6,8-dimethylquinoline-4-carboxylic acid. InChIKey: NASQRPYCEFNUAQ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 2-(furan-2-yl)-6,8-dimethylquinoline-4-carboxylic acid |
| InChIKey | NASQRPYCEFNUAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C3=CC=CO3)C(=O)O)C |
Computed by PubChem (NCBI)