CAS 158722-22-6 appears in our catalog under these names: (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid, 97%, (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid 95%, (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid, 95%, 95%, (4S,5R)-2,4-Diphenyl-4,5-dihydrooxazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100mg.
(4S,5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid (CAS 158722-22-6) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: (4S,5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid. InChIKey: BPBOFBFRBITMMR-UONOGXRCSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | (4S,5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazole-5-carboxylic acid |
| InChIKey | BPBOFBFRBITMMR-UONOGXRCSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]2[C@@H](OC(=N2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)