CAS 24370-74-9 appears in our catalog under these names: 6-(Benzyloxy)-1h-indole-3-carboxylic acid, 95%, 6-(Benzyloxy)-1H-indole-3-carboxylic acid 96%, 6-(Benzyloxy)-1H-indole-3-carboxylic acid, 96%, 96%, 6-(Benzyloxy)-1H-indole-3-carboxylic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 100mg, 5g.
6-phenylmethoxy-1H-indole-3-carboxylic acid (CAS 24370-74-9) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 6-phenylmethoxy-1H-indole-3-carboxylic acid. InChIKey: BZTJFYMDTZJVNP-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 6-phenylmethoxy-1H-indole-3-carboxylic acid |
| InChIKey | BZTJFYMDTZJVNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=CN3)C(=O)O |
Computed by PubChem (NCBI)