Products 588695-31-2
CAS 588695-31-2 appears in our catalog under these names: 2-(2-Furyl)-7,8-dimethylquinoline-4-carboxylic acid, 95%, 2-(Furan-2-yl)-7,8-dimethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(furan-2-yl)-7,8-dimethylquinoline-4-carboxylic acid (CAS 588695-31-2) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 2-(furan-2-yl)-7,8-dimethylquinoline-4-carboxylic acid. InChIKey: IDMLFUWRDFYFPS-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 2-(furan-2-yl)-7,8-dimethylquinoline-4-carboxylic acid |
| InChIKey | IDMLFUWRDFYFPS-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=N2)C3=CC=CO3)C(=O)O)C |
Computed by PubChem (NCBI)