CAS 16077-10-4 appears in our catalog under these names: 1-Benzyl-5-methoxy-2,3-dihydro-1h-indole-2,3-dione, 95%, 1-Benzyl-5-methoxyindoline-2,3-dione, 97%, 1–benzyl–5–methoxyindoline–2,3–dione. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
1-benzyl-5-methoxyindole-2,3-dione (CAS 16077-10-4) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 1-benzyl-5-methoxyindole-2,3-dione. InChIKey: ZBLQKVFGHHQVMS-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 1-benzyl-5-methoxyindole-2,3-dione |
| InChIKey | ZBLQKVFGHHQVMS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N(C(=O)C2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)