CAS 2365418-99-9 appears in our catalog under these names: Methyl 13-amino-2-oxatricyclo[9.4.0.0^{3,8}]pentadeca-1(15),3(8),4,6,9,11,13-heptaene-9-carboxylate, 95%, Methyl 2-aminodibenzo(b,f)oxepine-10-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 3-aminobenzo[b][1]benzoxepine-6-carboxylate (CAS 2365418-99-9) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: methyl 3-aminobenzo[b][1]benzoxepine-6-carboxylate. InChIKey: WPUBONXUJZTWKN-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | methyl 3-aminobenzo[b][1]benzoxepine-6-carboxylate |
| InChIKey | WPUBONXUJZTWKN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CC(=C2)N)OC3=CC=CC=C31 |
Computed by PubChem (NCBI)