cas: 588-64-7 — see every product listed under this CAS number, including other names
1-Benzylidene-2-phenylhydrazine, 97%, 97% (CAS 588-64-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114O1G-50g |
| cas | 588-64-7 |
| size | 50g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 784.40 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 462.80 Pln | |
| Chemat | 100g | 1355.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-[(E)-benzylideneamino]aniline (CAS 588-64-7) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: N-[(E)-benzylideneamino]aniline. InChIKey: JGOAZQAXRONCCI-SDNWHVSQSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | N-[(E)-benzylideneamino]aniline |
| InChIKey | JGOAZQAXRONCCI-SDNWHVSQSA-N |
| SMILES | C1=CC=C(C=C1)/C=N/NC2=CC=CC=C2 |
Computed by PubChem (NCBI)