cas: 588-64-7 — see every product listed under this CAS number, including other names
Benzaldehyde Phenylhydrazone (CAS 588-64-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD03583-100g |
| cas | 588-64-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 1547.18 Pln | |
| GLPBio | 10g | 592.36 Pln | |
| GLPBio | 25g | 770.22 Pln | |
| GLPBio | 5g | 517.47 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[(E)-benzylideneamino]aniline (CAS 588-64-7) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: N-[(E)-benzylideneamino]aniline. InChIKey: JGOAZQAXRONCCI-SDNWHVSQSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | N-[(E)-benzylideneamino]aniline |
| InChIKey | JGOAZQAXRONCCI-SDNWHVSQSA-N |
| SMILES | C1=CC=C(C=C1)/C=N/NC2=CC=CC=C2 |
Computed by PubChem (NCBI)