cas: 588-64-7 — see every product listed under this CAS number, including other names
1-Benzylidene-2-phenylhydrazine, 97% (CAS 588-64-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F464203-1G |
| cas | 588-64-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 253.05 Pln | |
| Fluorochem | 10g | 362.39 Pln | |
| Fluorochem | 25g | 622.72 Pln | |
| Fluorochem | 100g | 2325.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-[(E)-benzylideneamino]aniline (CAS 588-64-7) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: N-[(E)-benzylideneamino]aniline. InChIKey: JGOAZQAXRONCCI-SDNWHVSQSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | N-[(E)-benzylideneamino]aniline |
| InChIKey | JGOAZQAXRONCCI-SDNWHVSQSA-N |
| SMILES | C1=CC=C(C=C1)/C=N/NC2=CC=CC=C2 |
Computed by PubChem (NCBI)