1-Boc-3，3-difluoropyrrolidine, 97%, 97%
cas: 195447-25-7 — see every product listed under this CAS number, including other names
1-Boc-3，3-difluoropyrrolidine, 97%, 97% (CAS 195447-25-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UJJ-250mg |
| cas | 195447-25-7 |
| size | 250mg |
| availability | 75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 1043.60 Pln | |
| Chemat | 10g | 1835.60 Pln | |
| Chemat | 25g | 3606.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3,3-difluoropyrrolidine-1-carboxylate (CAS 195447-25-7) is a chemical compound with the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. IUPAC name: tert-butyl 3,3-difluoropyrrolidine-1-carboxylate. InChIKey: ULFWNKDACVUZOD-UHFFFAOYSA-N.
| Molecular formula | C9H15F2NO2 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | tert-butyl 3,3-difluoropyrrolidine-1-carboxylate |
| InChIKey | ULFWNKDACVUZOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)(F)F |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl 3,3-difluoropyrrolidine-1-carboxylate, 1-Boc-3,3-difluoropyrrolidine, N-t-BOC-3,3-Difluoropyrrolidine, 1-Pyrrolidinecarboxylicacid, 3,3-difluoro-, 1,1-dimethylethyl ester, Boc-3,3-difluoropyrrolidine, 1-Pyrrolidinecarboxylic acid, 3,3-difluoro-, 1,1-dimethylethyl ester, N-t-BOC-3,3-Difluoropyrrolidine, AldrichCPR