cas: 195447-25-7 — see every product listed under this CAS number, including other names
tert-Butyl 3,3-difluoropyrrolidine-1-carboxylate, 98% (CAS 195447-25-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235393-250MG |
| cas | 195447-25-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 1226.67 Pln | |
| Fluorochem | 10g | 2320.03 Pln | |
| Fluorochem | 25g | 4574.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3,3-difluoropyrrolidine-1-carboxylate (CAS 195447-25-7) is a chemical compound with the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. IUPAC name: tert-butyl 3,3-difluoropyrrolidine-1-carboxylate. InChIKey: ULFWNKDACVUZOD-UHFFFAOYSA-N.
| Molecular formula | C9H15F2NO2 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | tert-butyl 3,3-difluoropyrrolidine-1-carboxylate |
| InChIKey | ULFWNKDACVUZOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)(F)F |
Computed by PubChem (NCBI)