cas: 181365-26-4 — see every product listed under this CAS number, including other names
1-Boc-indole-3-boronic Acid, 97%, 97% (CAS 181365-26-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1133U0-100mg |
| cas | 181365-26-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 500mg | 102.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 362.00 Pln | |
| Chemat | 25g | 813.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]boronic acid (CAS 181365-26-4) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]boronic acid. InChIKey: UAGJZZDMFOTJRN-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO4 |
|---|---|
| Molecular weight | 261.08 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]boronic acid |
| InChIKey | UAGJZZDMFOTJRN-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C2=CC=CC=C12)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)