CAS 2102451-30-7 appears in our catalog under these names: (1-(tert-Butoxycarbonyl)-1h-indol-4-yl)boronic acid, 95%, (1–(tert–Butoxycarbonyl)–1H–indol–4–yl)boronic acid, (1-(tert-Butoxycarbonyl)-1H-indol-4-yl)boronic acid 95%, (1-(tert-Butoxycarbonyl)-1H-indol-4-yl)boronic acid, 95%, 95%, (1-(tert-Butoxycarbonyl)-1H-indol-4-yl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-4-yl]boronic acid (CAS 2102451-30-7) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]indol-4-yl]boronic acid. InChIKey: JFCFJRCULIWLNL-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO4 |
|---|---|
| Molecular weight | 261.08 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]indol-4-yl]boronic acid |
| InChIKey | JFCFJRCULIWLNL-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CN(C2=CC=C1)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)