CAS 1105710-32-4 appears in our catalog under these names: 2-Oxo-2,3-dihydrobenzo(d)oxazol-6-ylboronic Acid Pinacol Ester, 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo(d)oxazol-2(3H)-one, 98+%, 2-Oxo-2,3-dihydrobenzoxazole-6-boronic Acid Pinacol Ester. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 10mg, 50mg, 5mg, 10g, 2,5g, 250mg.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one (CAS 1105710-32-4) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one. InChIKey: RVSGJKHNWXFXCD-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO4 |
|---|---|
| Molecular weight | 261.08 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1,3-benzoxazol-2-one |
| InChIKey | RVSGJKHNWXFXCD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NC(=O)O3 |
Computed by PubChem (NCBI)