cas: 112822-78-3 — see every product listed under this CAS number, including other names
1-Bromo-2,4-difluoro-3-methyl-5-nitrobenzene, 97%, 97% (CAS 112822-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HCFW-100mg |
| cas | 112822-78-3 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 558.80 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 2363.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2,4-difluoro-3-methyl-5-nitrobenzene (CAS 112822-78-3) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 1-bromo-2,4-difluoro-3-methyl-5-nitrobenzene. InChIKey: XYHQHSNBEJANMZ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 1-bromo-2,4-difluoro-3-methyl-5-nitrobenzene |
| InChIKey | XYHQHSNBEJANMZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1F)Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)