Products 1208405-18-8
CAS 1208405-18-8 is the registry number for 2-(Bromomethyl)-1,3-difluoro-4-nitrobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(bromomethyl)-1,3-difluoro-4-nitrobenzene (CAS 1208405-18-8) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 2-(bromomethyl)-1,3-difluoro-4-nitrobenzene. InChIKey: XENWYBOBVSNBRA-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 2-(bromomethyl)-1,3-difluoro-4-nitrobenzene |
| InChIKey | XENWYBOBVSNBRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)CBr)F |
Computed by PubChem (NCBI)