Products 2923227-50-1
CAS 2923227-50-1 is the registry number for 7-Bromo-2,2-difluorobenzo[d][1,3]dioxol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 2923227-50-1) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 7-bromo-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: OYSXBNBVSPNJSD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 7-bromo-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | OYSXBNBVSPNJSD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1OC(O2)(F)F)Br)N |
Computed by PubChem (NCBI)