Products 1502092-66-1
CAS 1502092-66-1 is the registry number for 3-Amino-4-bromo-2,6-difluorobenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-amino-4-bromo-2,6-difluorobenzoic acid (CAS 1502092-66-1) is a chemical compound with the molecular formula C7H4BrF2NO2 and a molecular weight of 252.01 g/mol. IUPAC name: 3-amino-4-bromo-2,6-difluorobenzoic acid. InChIKey: BGBZOLGWHSNQSY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO2 |
|---|---|
| Molecular weight | 252.01 g/mol |
| IUPAC name | 3-amino-4-bromo-2,6-difluorobenzoic acid |
| InChIKey | BGBZOLGWHSNQSY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)N)F)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
3-amino-4-bromo-2,6-difluorobenzoic acid