cas: 573-97-7 — see every product listed under this CAS number, including other names
1-Bromo-2-naphthol, 98%, 98% (CAS 573-97-7) is a chemical reagent available from Chemat. Available pack sizes: 5kg, 10kg, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E4H-5kg |
| cas | 573-97-7 |
| size | 5kg |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5kg | 3787.20 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 117.20 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 250g | 328.40 Pln | |
| Chemat | 500g | 662.40 Pln | |
| Chemat | 1kg | 1245.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromonaphthalen-2-ol (CAS 573-97-7) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 1-bromonaphthalen-2-ol. InChIKey: FQJZPYXGPYJJIH-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 1-bromonaphthalen-2-ol |
| InChIKey | FQJZPYXGPYJJIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2Br)O |
Computed by PubChem (NCBI)