CAS 571-57-3 appears in our catalog under these names: 4-Bromonaphthalen-1-ol, >97.0%(GC), 4-Bromonaphthalen-1-ol 97%, 4-BROMO-1-NAPHTHOL, 95%, 4-Bromonaphthalen-1-ol, 98%, 98%, 4-Bromo-1-naphthalenol, 95%. Offered by: TCI, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1000g, 250mg, 1g, 5g, 10g, 500g.
4-bromonaphthalen-1-ol (CAS 571-57-3) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 4-bromonaphthalen-1-ol. InChIKey: OUNQUWORSXHSJN-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 4-bromonaphthalen-1-ol |
| InChIKey | OUNQUWORSXHSJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)O |
Computed by PubChem (NCBI)