CAS 38527-58-1 appears in our catalog under these names: 2-(2-Bromophenyl)furan, 95-<97%, 2-(2-Bromophenyl)furan, 97% . Offered by: Hoffman Fine Chemicals, Thermo Scientific. Available pack sizes: 10g, 25g, 50g, 100g, 1g.
2-(2-bromophenyl)furan (CAS 38527-58-1) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 2-(2-bromophenyl)furan. InChIKey: YWWTWWDBLGSPAA-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 2-(2-bromophenyl)furan |
| InChIKey | YWWTWWDBLGSPAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CO2)Br |
Computed by PubChem (NCBI)