CAS 116632-05-4 appears in our catalog under these names: 5-Bromo-2-naphthalenol, 5-Bromonaphthalen-2-ol 95%, 5-Bromonaphthalen-2-ol, 95%, 95%, 5-BROMO-2-NAPHTHOL, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g, 10g.
5-bromonaphthalen-2-ol (CAS 116632-05-4) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 5-bromonaphthalen-2-ol. InChIKey: BZCYULYTYLSGBX-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 5-bromonaphthalen-2-ol |
| InChIKey | BZCYULYTYLSGBX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C(=C1)Br |
Computed by PubChem (NCBI)