CAS 2181763-50-6 is the registry number for 2-Bromo-1,6a-dihydrocyclopropa[a]inden-6(1aH)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one (CAS 2181763-50-6) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one. InChIKey: PZLKGKLADWXNKJ-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 2-bromo-1a,6a-dihydro-1H-cyclopropa[a]inden-6-one |
| InChIKey | PZLKGKLADWXNKJ-UHFFFAOYSA-N |
| SMILES | C1C2C1C(=O)C3=C2C(=CC=C3)Br |
Computed by PubChem (NCBI)