CAS 52927-23-8 appears in our catalog under these names: 5-Bromo-1-naphthol, 95%, 5–Bromonaphthalen–1–ol, 5-Bromonaphthalen-1-ol, 5-Bromonaphthalen-1-ol 95%, 5-Bromonaphthalen-1-ol, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 2g, 5g, 10g.
5-bromonaphthalen-1-ol (CAS 52927-23-8) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 5-bromonaphthalen-1-ol. InChIKey: VVBDRNNSHAFBJW-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 5-bromonaphthalen-1-ol |
| InChIKey | VVBDRNNSHAFBJW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2Br)C(=C1)O |
Computed by PubChem (NCBI)