CAS 14297-34-8 appears in our catalog under these names: 2-(4-bromophenyl)furan, 2-(4-Bromophenyl)furan, 97% , 2-(4-Bromophenyl)furan, 95%, 95%. Offered by: TRC, Thermo Scientific, Chemat. Available pack sizes: 500mg, 250MG, 1g, 100mg.
2-(4-bromophenyl)furan (CAS 14297-34-8) is a chemical compound with the molecular formula C10H7BrO and a molecular weight of 223.07 g/mol. IUPAC name: 2-(4-bromophenyl)furan. InChIKey: FBIKSVALROQWIY-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 2-(4-bromophenyl)furan |
| InChIKey | FBIKSVALROQWIY-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)