cas: 18739-03-2 — see every product listed under this CAS number, including other names
1-Bromo-3-(pentafluoroethyl)benzene 95% (CAS 18739-03-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A803965-100mg |
| cas | 18739-03-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 5565.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A803965 |
1-bromo-3-(1,1,2,2,2-pentafluoroethyl)benzene (CAS 18739-03-2) is a chemical compound with the molecular formula C8H4BrF5 and a molecular weight of 275.01 g/mol. IUPAC name: 1-bromo-3-(1,1,2,2,2-pentafluoroethyl)benzene. InChIKey: VNDBRXJSZAABBZ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5 |
|---|---|
| Molecular weight | 275.01 g/mol |
| IUPAC name | 1-bromo-3-(1,1,2,2,2-pentafluoroethyl)benzene |
| InChIKey | VNDBRXJSZAABBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)