CAS 1416980-74-9 is the registry number for 1-(1-Bromo-2,2,2-trifluoroethyl)-3,5-difluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(1-bromo-2,2,2-trifluoroethyl)-3,5-difluorobenzene (CAS 1416980-74-9) is a chemical compound with the molecular formula C8H4BrF5 and a molecular weight of 275.01 g/mol. IUPAC name: 1-(1-bromo-2,2,2-trifluoroethyl)-3,5-difluorobenzene. InChIKey: TXQXSEBLEYFAHH-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5 |
|---|---|
| Molecular weight | 275.01 g/mol |
| IUPAC name | 1-(1-bromo-2,2,2-trifluoroethyl)-3,5-difluorobenzene |
| InChIKey | TXQXSEBLEYFAHH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(C(F)(F)F)Br |
Computed by PubChem (NCBI)