Products 2149589-86-4
CAS 2149589-86-4 is the registry number for 2,6-Difluoro-3-(trifluoromethyl)benzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(bromomethyl)-1,3-difluoro-4-(trifluoromethyl)benzene (CAS 2149589-86-4) is a chemical compound with the molecular formula C8H4BrF5 and a molecular weight of 275.01 g/mol. IUPAC name: 2-(bromomethyl)-1,3-difluoro-4-(trifluoromethyl)benzene. InChIKey: SWPSKNOJWNSFAT-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5 |
|---|---|
| Molecular weight | 275.01 g/mol |
| IUPAC name | 2-(bromomethyl)-1,3-difluoro-4-(trifluoromethyl)benzene |
| InChIKey | SWPSKNOJWNSFAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)CBr)F |
Computed by PubChem (NCBI)