Products 239079-92-6
CAS 239079-92-6 is the registry number for 3,4-Difluoro-5-(trifluoromethyl)benzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-(bromomethyl)-1,2-difluoro-3-(trifluoromethyl)benzene (CAS 239079-92-6) is a chemical compound with the molecular formula C8H4BrF5 and a molecular weight of 275.01 g/mol. IUPAC name: 5-(bromomethyl)-1,2-difluoro-3-(trifluoromethyl)benzene. InChIKey: ARGQEGUGAFKWBO-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5 |
|---|---|
| Molecular weight | 275.01 g/mol |
| IUPAC name | 5-(bromomethyl)-1,2-difluoro-3-(trifluoromethyl)benzene |
| InChIKey | ARGQEGUGAFKWBO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)F)CBr |
Computed by PubChem (NCBI)