CAS 213203-85-1 is the registry number for 2,3-Difluoro-4-(trifluoromethyl)benzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(bromomethyl)-2,3-difluoro-4-(trifluoromethyl)benzene (CAS 213203-85-1) is a chemical compound with the molecular formula C8H4BrF5 and a molecular weight of 275.01 g/mol. IUPAC name: 1-(bromomethyl)-2,3-difluoro-4-(trifluoromethyl)benzene. InChIKey: CSCQGNZVBJMHGR-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5 |
|---|---|
| Molecular weight | 275.01 g/mol |
| IUPAC name | 1-(bromomethyl)-2,3-difluoro-4-(trifluoromethyl)benzene |
| InChIKey | CSCQGNZVBJMHGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CBr)F)F)C(F)(F)F |
Computed by PubChem (NCBI)