Products 1445995-80-1
CAS 1445995-80-1 appears in our catalog under these names: 1-(Bromomethyl)-2,4-difluoro-3-(trifluoromethyl)benzene, 95%, 2,4-Difluoro-3-(trifluoromethyl)benzyl bromide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-(bromomethyl)-2,4-difluoro-3-(trifluoromethyl)benzene (CAS 1445995-80-1) is a chemical compound with the molecular formula C8H4BrF5 and a molecular weight of 275.01 g/mol. IUPAC name: 1-(bromomethyl)-2,4-difluoro-3-(trifluoromethyl)benzene. InChIKey: WXGJNEQJYXWCQZ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5 |
|---|---|
| Molecular weight | 275.01 g/mol |
| IUPAC name | 1-(bromomethyl)-2,4-difluoro-3-(trifluoromethyl)benzene |
| InChIKey | WXGJNEQJYXWCQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CBr)F)C(F)(F)F)F |
Computed by PubChem (NCBI)