Products 1934665-18-5
CAS 1934665-18-5 appears in our catalog under these names: 2,4-Difluoro-5-(trifluoromethyl)benzyl bromide, 97%, 1-(Bromomethyl)-2,4-difluoro-5-(trifluoromethyl)benzene, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(bromomethyl)-2,4-difluoro-5-(trifluoromethyl)benzene (CAS 1934665-18-5) is a chemical compound with the molecular formula C8H4BrF5 and a molecular weight of 275.01 g/mol. IUPAC name: 1-(bromomethyl)-2,4-difluoro-5-(trifluoromethyl)benzene. InChIKey: LXQOUUTWBTWLAB-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5 |
|---|---|
| Molecular weight | 275.01 g/mol |
| IUPAC name | 1-(bromomethyl)-2,4-difluoro-5-(trifluoromethyl)benzene |
| InChIKey | LXQOUUTWBTWLAB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(F)(F)F)F)F)CBr |
Computed by PubChem (NCBI)