cas: 1035155-54-4 — see every product listed under this CAS number, including other names
1-Bromo-3-benzyloxy-4,5-difluorobenzene, ≥95%, ≥95% (CAS 1035155-54-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DL8H-1g |
| cas | 1035155-54-4 |
| size | 1g |
| availability | 41g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1499.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1,2-difluoro-3-phenylmethoxybenzene (CAS 1035155-54-4) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: 5-bromo-1,2-difluoro-3-phenylmethoxybenzene. InChIKey: WCFYSBZEQRGHMY-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2O |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 5-bromo-1,2-difluoro-3-phenylmethoxybenzene |
| InChIKey | WCFYSBZEQRGHMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=CC(=C2)Br)F)F |
Computed by PubChem (NCBI)