CAS 1698908-86-9 appears in our catalog under these names: 1-Bromo-4,5-difluoro-2-(phenylmethoxy)benzene, 97%, 1-(Benzyloxy)-2-bromo-4,5-difluorobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
1-bromo-4,5-difluoro-2-phenylmethoxybenzene (CAS 1698908-86-9) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: 1-bromo-4,5-difluoro-2-phenylmethoxybenzene. InChIKey: ZNXTWZWOTZEQSN-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2O |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 1-bromo-4,5-difluoro-2-phenylmethoxybenzene |
| InChIKey | ZNXTWZWOTZEQSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2Br)F)F |
Computed by PubChem (NCBI)