CAS 1035155-54-4 appears in our catalog under these names: 1-(Benzyloxy)-5-bromo-2,3-difluorobenzene, 95%, 1-(Benzyloxy)-5-bromo-2,3-difluorobenzene, 97%, 1-Bromo-3-benzyloxy-4,5-difluorobenzene, ≥95%, ≥95%, 1-Bromo-3-benzyloxy-4,5-difluorobenzene. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
5-bromo-1,2-difluoro-3-phenylmethoxybenzene (CAS 1035155-54-4) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: 5-bromo-1,2-difluoro-3-phenylmethoxybenzene. InChIKey: WCFYSBZEQRGHMY-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2O |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 5-bromo-1,2-difluoro-3-phenylmethoxybenzene |
| InChIKey | WCFYSBZEQRGHMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=CC(=C2)Br)F)F |
Computed by PubChem (NCBI)