CAS 901238-24-2 appears in our catalog under these names: 1-Benzyloxy-4-bromo-2,5-difluorobenzene, 97%, 1-(Benzyloxy)-4-bromo-2,5-difluorobenzene, 97%, 1-(Benzyloxy)-4-bromo-2,5-difluorobenzene 98%, 1-(Benzyloxy)-4-bromo-2,5-difluorobenzene, 98%, 98%, 1-Benzyloxy-4-bromo-2,5-difluorobenzene, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 250mg.
1-bromo-2,5-difluoro-4-phenylmethoxybenzene (CAS 901238-24-2) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: 1-bromo-2,5-difluoro-4-phenylmethoxybenzene. InChIKey: AMCJPMDOXRAQCK-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2O |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 1-bromo-2,5-difluoro-4-phenylmethoxybenzene |
| InChIKey | AMCJPMDOXRAQCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2F)Br)F |
Computed by PubChem (NCBI)