CAS 942143-10-4 appears in our catalog under these names: 2-(Benzyloxy)-1-bromo-3,5-difluorobenzene, 98%, 2-(Benzyloxy)-1-bromo-3,5-difluorobenzene, 97%, 97%, 1-Bromo-2-benzyloxy-3,5-difluorobenzene, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
1-bromo-3,5-difluoro-2-phenylmethoxybenzene (CAS 942143-10-4) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: 1-bromo-3,5-difluoro-2-phenylmethoxybenzene. InChIKey: NDAUCIQBUUEETC-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2O |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 1-bromo-3,5-difluoro-2-phenylmethoxybenzene |
| InChIKey | NDAUCIQBUUEETC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Br)F)F |
Computed by PubChem (NCBI)