Products 2230481-34-0

CAS 2230481-34-0 is the registry number for 1-Benzyloxy-6-bromo-2,3-difluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-bromo-3,4-difluoro-2-phenylmethoxybenzene (CAS 2230481-34-0) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: 1-bromo-3,4-difluoro-2-phenylmethoxybenzene. InChIKey: FBSLOZVWXBIZEK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9BrF2O
Molecular weight299.11 g/mol
IUPAC name1-bromo-3,4-difluoro-2-phenylmethoxybenzene
InChIKeyFBSLOZVWXBIZEK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=CC(=C2F)F)Br

Computed by PubChem (NCBI)